About 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane
11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane (PubChem CID 176564044) has the molecular formula C13H27F2NO2
and a molecular weight of 267.36 g/mol. Its IUPAC name is 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane.
Molecular Properties
| Compound Name | 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane |
| PubChem CID | 176564044 |
| Molecular Formula | C13H27F2NO2 |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane |
| SMILES | CC.CC.CN1CCC2(OCCCO2)C(F)(F)C1 |
| InChI | InChI=1S/C9H15F2NO2.2C2H6/c1-12-4-3-9(8(10,11)7-12)13-5-2-6-14-9;2*1-2/h2-7H2,1H3;2*1-2H3 |
| InChIKey | HRFKTWUURCCWQF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane?
The IUPAC name of 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane (CID 176564044) is 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane.
What is the SMILES notation for 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane?
The canonical SMILES for 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane is CC.CC.CN1CCC2(OCCCO2)C(F)(F)C1.
What is the InChIKey of 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane?
The InChIKey is HRFKTWUURCCWQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2.2C2H6/c1-12-4-3-9(8(10,11)7-12)13-5-2-6-14-9;2*1-2/h2-7H2,1H3;2*1-2H3.
What are the key properties of 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane?
11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane has a molecular weight of 267.36 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane;ethane is sourced from PubChem (CID 176564044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).