About methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate
methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate (PubChem CID 176564252) has the molecular formula C13H10FNO3
and a molecular weight of 247.22 g/mol. Its IUPAC name is methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate |
| PubChem CID | 176564252 |
| Molecular Formula | C13H10FNO3 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)-c1ccc(F)cc1OC2 |
| InChI | InChI=1S/C13H10FNO3/c1-17-13(16)10-4-7-6-18-11-5-8(14)2-3-9(11)12(7)15-10/h2-5,15H,6H2,1H3 |
| InChIKey | XYGMCWKCUJFWLM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate?
The IUPAC name of methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate (CID 176564252) is methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate.
What is the SMILES notation for methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate?
The canonical SMILES for methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate is COC(=O)c1cc2c([nH]1)-c1ccc(F)cc1OC2.
What is the InChIKey of methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate?
The InChIKey is XYGMCWKCUJFWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FNO3/c1-17-13(16)10-4-7-6-18-11-5-8(14)2-3-9(11)12(7)15-10/h2-5,15H,6H2,1H3.
What are the key properties of methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate?
methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate has a molecular weight of 247.22 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-fluoro-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate is sourced from PubChem (CID 176564252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).