About methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate
methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate (PubChem CID 176564289) has the molecular formula C20H16FNO3
and a molecular weight of 337.35 g/mol. Its IUPAC name is methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate |
| PubChem CID | 176564289 |
| Molecular Formula | C20H16FNO3 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2c(c1-c1ccc(F)cc1C)COc1ccccc1-2 |
| InChI | InChI=1S/C20H16FNO3/c1-11-9-12(21)7-8-13(11)17-15-10-25-16-6-4-3-5-14(16)18(15)22-19(17)20(23)24-2/h3-9,22H,10H2,1-2H3 |
| InChIKey | KVNPYAVSLKVADL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate?
The IUPAC name of methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate (CID 176564289) is methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate.
What is the SMILES notation for methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate?
The canonical SMILES for methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate is COC(=O)c1[nH]c2c(c1-c1ccc(F)cc1C)COc1ccccc1-2.
What is the InChIKey of methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate?
The InChIKey is KVNPYAVSLKVADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FNO3/c1-11-9-12(21)7-8-13(11)17-15-10-25-16-6-4-3-5-14(16)18(15)22-19(17)20(23)24-2/h3-9,22H,10H2,1-2H3.
What are the key properties of methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate?
methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate has a molecular weight of 337.35 g/mol, XLogP of 4.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-fluoro-2-methylphenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate is sourced from PubChem (CID 176564289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).