About 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid
3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid (PubChem CID 176564323) has the molecular formula C18H12ClNO3
and a molecular weight of 325.75 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid |
| PubChem CID | 176564323 |
| Molecular Formula | C18H12ClNO3 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2c(c1-c1cccc(Cl)c1)COc1ccccc1-2 |
| InChI | InChI=1S/C18H12ClNO3/c19-11-5-3-4-10(8-11)15-13-9-23-14-7-2-1-6-12(14)16(13)20-17(15)18(21)22/h1-8,20H,9H2,(H,21,22) |
| InChIKey | CXXSIMXTLHEWHX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid?
The IUPAC name of 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid (CID 176564323) is 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid.
What is the SMILES notation for 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid?
The canonical SMILES for 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid is O=C(O)c1[nH]c2c(c1-c1cccc(Cl)c1)COc1ccccc1-2.
What is the InChIKey of 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid?
The InChIKey is CXXSIMXTLHEWHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClNO3/c19-11-5-3-4-10(8-11)15-13-9-23-14-7-2-1-6-12(14)16(13)20-17(15)18(21)22/h1-8,20H,9H2,(H,21,22).
What are the key properties of 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid?
3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid has a molecular weight of 325.75 g/mol, XLogP of 4.59, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylic acid is sourced from PubChem (CID 176564323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).