C30H40N4O3 — CID 176564690
11-amino-13-ethyl-2,10,12-triazapentacyclo[16.5.2.210,13.14,8.021,24]octacosa-4,6,8(28),11,18(25),19,21(24)-heptaene-3,27-dione;methoxyethane (PubChem CID 176564690) has the molecular formula C30H40N4O3 and a molecular weight of 504.68 g/mol. Its IUPAC name is 11-amino-13-ethyl-2,10,12-triazapentacyclo[16.5.2.210,13.14,8.021,24]octacosa-4,6,8(28),11,18(25),19,21(24)-heptaene-3,27-dione;methoxyethane.
| Compound Name | 11-amino-13-ethyl-2,10,12-triazapentacyclo[16.5.2.210,13.14,8.021,24]octacosa-4,6,8(28),11,18(25),19,21(24)-heptaene-3,27-dione;methoxyethane |
|---|---|
| PubChem CID | 176564690 |
| Molecular Formula | C30H40N4O3 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | 11-amino-13-ethyl-2,10,12-triazapentacyclo[16.5.2.210,13.14,8.021,24]octacosa-4,6,8(28),11,18(25),19,21(24)-heptaene-3,27-dione;methoxyethane |
| SMILES | CCC12CCCCc3ccc4c(c3)C(CC4)NC(=O)c3cccc(c3)CN(C(=O)C1)C(N)=N2.CCOC |
| InChI | InChI=1S/C27H32N4O2.C3H8O/c1-2-27-13-4-3-6-18-9-10-20-11-12-23(22(20)15-18)29-25(33)21-8-5-7-19(14-21)17-31(24(32)16-27)26(28)30-27;1-3-4-2/h5,7-10,14-15,23H,2-4,6,11-13,16-17H2,1H3,(H2,28,30)(H,29,33);3H2,1-2H3 |
| InChIKey | USNULIIQKUXPAN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |