C34H48N4O6 — CID 176564748
tert-butyl N-[(2E,20S)-6-ethyl-22,22-dimethyl-18,29-dioxo-13,23-dioxa-7,9,19-triazapentacyclo[18.6.2.26,9.010,15.024,28]triaconta-1(27),2,7,24(28),25-pentaen-8-yl]carbamate (PubChem CID 176564748) has the molecular formula C34H48N4O6 and a molecular weight of 608.78 g/mol. Its IUPAC name is tert-butyl N-[(2E,20S)-6-ethyl-22,22-dimethyl-18,29-dioxo-13,23-dioxa-7,9,19-triazapentacyclo[18.6.2.26,9.010,15.024,28]triaconta-1(27),2,7,24(28),25-pentaen-8-yl]carbamate.
| Compound Name | tert-butyl N-[(2E,20S)-6-ethyl-22,22-dimethyl-18,29-dioxo-13,23-dioxa-7,9,19-triazapentacyclo[18.6.2.26,9.010,15.024,28]triaconta-1(27),2,7,24(28),25-pentaen-8-yl]carbamate |
|---|---|
| PubChem CID | 176564748 |
| Molecular Formula | C34H48N4O6 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | tert-butyl N-[(2E,20S)-6-ethyl-22,22-dimethyl-18,29-dioxo-13,23-dioxa-7,9,19-triazapentacyclo[18.6.2.26,9.010,15.024,28]triaconta-1(27),2,7,24(28),25-pentaen-8-yl]carbamate |
| SMILES | CCC12CC/C=C/c3ccc4c(c3)[C@H](CC(C)(C)O4)NC(=O)CCC3COCCC3N(C(=O)C1)C(NC(=O)OC(C)(C)C)=N2 |
| InChI | InChI=1S/C34H48N4O6/c1-7-34-16-9-8-10-22-11-13-27-24(18-22)25(19-33(5,6)43-27)35-28(39)14-12-23-21-42-17-15-26(23)38(29(40)20-34)30(37-34)36-31(41)44-32(2,3)4/h8,10-11,13,18,23,25-26H,7,9,12,14-17,19-21H2,1-6H3,(H,35,39)(H,36,37,41)/b10-8+/t23?,25-,26?,34?/m0/s1 |
| InChIKey | IZDYPKNDVUDHSM-JAANBLLOSA-N |
| XLogP | 5.66 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |