C29H34N4O3 — CID 176564768
(1R,9R,13R,16E,23R)-11-amino-9,13-diethyl-23-hydroxy-2,10,12-triazapentacyclo[16.5.2.210,13.14,8.021,24]octacosa-4,6,8(28),11,16,18(25),19,21(24)-octaene-3,27-dione (PubChem CID 176564768) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is (1R,9R,13R,16E,23R)-11-amino-9,13-diethyl-23-hydroxy-2,10,12-triazapentacyclo[16.5.2.210,13.14,8.021,24]octacosa-4,6,8(28),11,16,18(25),19,21(24)-octaene-3,27-dione.
| Compound Name | (1R,9R,13R,16E,23R)-11-amino-9,13-diethyl-23-hydroxy-2,10,12-triazapentacyclo[16.5.2.210,13.14,8.021,24]octacosa-4,6,8(28),11,16,18(25),19,21(24)-octaene-3,27-dione |
|---|---|
| PubChem CID | 176564768 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (1R,9R,13R,16E,23R)-11-amino-9,13-diethyl-23-hydroxy-2,10,12-triazapentacyclo[16.5.2.210,13.14,8.021,24]octacosa-4,6,8(28),11,16,18(25),19,21(24)-octaene-3,27-dione |
| SMILES | CC[C@@H]1c2cccc(c2)C(=O)N[C@@H]2c3cc(ccc3C[C@H]2O)/C=C\CC[C@]2(CC)CC(=O)N1C(N)=N2 |
| InChI | InChI=1S/C29H34N4O3/c1-3-23-20-9-7-10-21(15-20)27(36)31-26-22-14-18(11-12-19(22)16-24(26)34)8-5-6-13-29(4-2)17-25(35)33(23)28(30)32-29/h5,7-12,14-15,23-24,26,34H,3-4,6,13,16-17H2,1-2H3,(H2,30,32)(H,31,36)/b8-5-/t23-,24-,26-,29-/m1/s1 |
| InChIKey | BYWPJOQQYQKGKA-RITUXHCBSA-N |
| XLogP | 4.03 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |