C26H32F2N4O3 — CID 176564848
22-amino-12-(difluoromethoxy)-1,9,21-triazatetracyclo[18.2.2.13,7.111,15]hexacosa-3(26),4,6,11,13,15(25),21-heptaene-8,23-dione;ethane (PubChem CID 176564848) has the molecular formula C26H32F2N4O3 and a molecular weight of 486.56 g/mol. Its IUPAC name is 22-amino-12-(difluoromethoxy)-1,9,21-triazatetracyclo[18.2.2.13,7.111,15]hexacosa-3(26),4,6,11,13,15(25),21-heptaene-8,23-dione;ethane.
| Compound Name | 22-amino-12-(difluoromethoxy)-1,9,21-triazatetracyclo[18.2.2.13,7.111,15]hexacosa-3(26),4,6,11,13,15(25),21-heptaene-8,23-dione;ethane |
|---|---|
| PubChem CID | 176564848 |
| Molecular Formula | C26H32F2N4O3 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 22-amino-12-(difluoromethoxy)-1,9,21-triazatetracyclo[18.2.2.13,7.111,15]hexacosa-3(26),4,6,11,13,15(25),21-heptaene-8,23-dione;ethane |
| SMILES | CC.NC1=NC2CCCCc3ccc(OC(F)F)c(c3)CNC(=O)c3cccc(c3)CN1C(=O)C2 |
| InChI | InChI=1S/C24H26F2N4O3.C2H6/c25-23(26)33-20-9-8-15-4-1-2-7-19-12-21(31)30(24(27)29-19)14-16-5-3-6-17(11-16)22(32)28-13-18(20)10-15;1-2/h3,5-6,8-11,19,23H,1-2,4,7,12-14H2,(H2,27,29)(H,28,32);1-2H3 |
| InChIKey | IMTNTZUAAAPLAH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |