C30H29FN6O5 — CID 176565190
1-[1-[4-(5-cyano-3-pyridinyl)-2-methoxyphenyl]ethyl]-3-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-2-fluoro-4-formylphenyl]urea (PubChem CID 176565190) has the molecular formula C30H29FN6O5 and a molecular weight of 572.60 g/mol. Its IUPAC name is 1-[1-[4-(5-cyano-3-pyridinyl)-2-methoxyphenyl]ethyl]-3-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-2-fluoro-4-formylphenyl]urea.
| Compound Name | 1-[1-[4-(5-cyano-3-pyridinyl)-2-methoxyphenyl]ethyl]-3-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-2-fluoro-4-formylphenyl]urea |
|---|---|
| PubChem CID | 176565190 |
| Molecular Formula | C30H29FN6O5 |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 1-[1-[4-(5-cyano-3-pyridinyl)-2-methoxyphenyl]ethyl]-3-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-2-fluoro-4-formylphenyl]urea |
| SMILES | COc1cc(-c2cncc(C#N)c2)ccc1C(C)NC(=O)Nc1ccc(C=O)c(CN(C)C2CCC(=O)NC2=O)c1F |
| InChI | InChI=1S/C30H29FN6O5/c1-17(22-6-4-19(11-26(22)42-3)21-10-18(12-32)13-33-14-21)34-30(41)35-24-7-5-20(16-38)23(28(24)31)15-37(2)25-8-9-27(39)36-29(25)40/h4-7,10-11,13-14,16-17,25H,8-9,15H2,1-3H3,(H2,34,35,41)(H,36,39,40) |
| InChIKey | ZJCNVTOJSUFTMV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|