C11H23NO4 — CID 176565208
(3S,5S)-N-butan-2-yl-3,5-dihydroxy-6-methoxyhexanamide (PubChem CID 176565208) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is (3S,5S)-N-butan-2-yl-3,5-dihydroxy-6-methoxyhexanamide.
| Compound Name | (3S,5S)-N-butan-2-yl-3,5-dihydroxy-6-methoxyhexanamide |
|---|---|
| PubChem CID | 176565208 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (3S,5S)-N-butan-2-yl-3,5-dihydroxy-6-methoxyhexanamide |
| SMILES | CCC(C)NC(=O)C[C@@H](O)C[C@H](O)COC |
| InChI | InChI=1S/C11H23NO4/c1-4-8(2)12-11(15)6-9(13)5-10(14)7-16-3/h8-10,13-14H,4-7H2,1-3H3,(H,12,15)/t8?,9-,10-/m0/s1 |
| InChIKey | XQZXMCNUPMNLIG-AGROOBSYSA-N |
| XLogP | 0.05 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |