About (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane
(2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane (PubChem CID 176565329) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane.
Molecular Properties
| Compound Name | (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane |
| PubChem CID | 176565329 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane |
| SMILES | C/C=C\C=c1\[nH]c(CC)c(C(C)=O)c(=O)\c1=C\C.CC |
| InChI | InChI=1S/C15H19NO2.C2H6/c1-5-8-9-13-11(6-2)15(18)14(10(4)17)12(7-3)16-13;1-2/h5-6,8-9,16H,7H2,1-4H3;1-2H3/b8-5-,11-6+,13-9+; |
| InChIKey | PUCIFAVIEBJMAQ-JTLGAVOASA-N |
| XLogP | 2.32 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane?
The IUPAC name of (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane (CID 176565329) is (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane.
What is the SMILES notation for (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane?
The canonical SMILES for (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane is C/C=C\C=c1\[nH]c(CC)c(C(C)=O)c(=O)\c1=C\C.CC.
What is the InChIKey of (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane?
The InChIKey is PUCIFAVIEBJMAQ-JTLGAVOASA-N. The full InChI is InChI=1S/C15H19NO2.C2H6/c1-5-8-9-13-11(6-2)15(18)14(10(4)17)12(7-3)16-13;1-2/h5-6,8-9,16H,7H2,1-4H3;1-2H3/b8-5-,11-6+,13-9+;.
What are the key properties of (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane?
(2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane has a molecular weight of 275.39 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-5-acetyl-2-[(Z)-but-2-enylidene]-6-ethyl-3-ethylidene-1H-pyridin-4-one;ethane is sourced from PubChem (CID 176565329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).