C21H25FN7OP — CID 176565939
5-dimethylphosphoryl-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-6-piperazin-1-yl-1H-indazol-3-amine (PubChem CID 176565939) has the molecular formula C21H25FN7OP and a molecular weight of 441.45 g/mol. Its IUPAC name is 5-dimethylphosphoryl-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-6-piperazin-1-yl-1H-indazol-3-amine.
| Compound Name | 5-dimethylphosphoryl-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-6-piperazin-1-yl-1H-indazol-3-amine |
|---|---|
| PubChem CID | 176565939 |
| Molecular Formula | C21H25FN7OP |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 5-dimethylphosphoryl-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-6-piperazin-1-yl-1H-indazol-3-amine |
| SMILES | Cc1cn2cc(Nc3n[nH]c4cc(N5CCNCC5)c(P(C)(C)=O)cc34)cc(F)c2n1 |
| InChI | InChI=1S/C21H25FN7OP/c1-13-11-29-12-14(8-16(22)21(29)24-13)25-20-15-9-19(31(2,3)30)18(10-17(15)26-27-20)28-6-4-23-5-7-28/h8-12,23H,4-7H2,1-3H3,(H2,25,26,27) |
| InChIKey | JWORAAKYXYXQBV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|