C23H20F2N4O5 — CID 176567519
4-[(5,7-dimethoxy-1,6-naphthyridin-4-yl)oxy]-3,5-difluoroaniline;4-methoxypyridine-3-carbaldehyde (PubChem CID 176567519) has the molecular formula C23H20F2N4O5 and a molecular weight of 470.43 g/mol. Its IUPAC name is 4-[(5,7-dimethoxy-1,6-naphthyridin-4-yl)oxy]-3,5-difluoroaniline;4-methoxypyridine-3-carbaldehyde.
| Compound Name | 4-[(5,7-dimethoxy-1,6-naphthyridin-4-yl)oxy]-3,5-difluoroaniline;4-methoxypyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 176567519 |
| Molecular Formula | C23H20F2N4O5 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 4-[(5,7-dimethoxy-1,6-naphthyridin-4-yl)oxy]-3,5-difluoroaniline;4-methoxypyridine-3-carbaldehyde |
| SMILES | COc1cc2nccc(Oc3c(F)cc(N)cc3F)c2c(OC)n1.COc1ccncc1C=O |
| InChI | InChI=1S/C16H13F2N3O3.C7H7NO2/c1-22-13-7-11-14(16(21-13)23-2)12(3-4-20-11)24-15-9(17)5-8(19)6-10(15)18;1-10-7-2-3-8-4-6(7)5-9/h3-7H,19H2,1-2H3;2-5H,1H3 |
| InChIKey | CUCIDWXIHNHHRW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|