About 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one
4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one (PubChem CID 176568211) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one.
Molecular Properties
| Compound Name | 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one |
| PubChem CID | 176568211 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one |
| SMILES | C=CC1=C(C(=C)F)N(CC)C(=O)C1(C)CC |
| InChI | InChI=1S/C13H18FNO/c1-6-10-11(9(4)14)15(8-3)12(16)13(10,5)7-2/h6H,1,4,7-8H2,2-3,5H3 |
| InChIKey | AAAGTNBFADCVOF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one?
The IUPAC name of 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one (CID 176568211) is 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one.
What is the SMILES notation for 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one?
The canonical SMILES for 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one is C=CC1=C(C(=C)F)N(CC)C(=O)C1(C)CC.
What is the InChIKey of 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one?
The InChIKey is AAAGTNBFADCVOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO/c1-6-10-11(9(4)14)15(8-3)12(16)13(10,5)7-2/h6H,1,4,7-8H2,2-3,5H3.
What are the key properties of 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one?
4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one has a molecular weight of 223.29 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1,3-diethyl-5-(1-fluoroethenyl)-3-methylpyrrol-2-one is sourced from PubChem (CID 176568211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).