About 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate
2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate (PubChem CID 176568416) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate.
Analyze 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate?
The IUPAC name of 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate (CID 176568416) is 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate.
What is the SMILES notation for 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate?
The canonical SMILES for 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate is CNC(=O)OC1CC2CCCN2C1.
What is the InChIKey of 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate?
The InChIKey is MDXNEQQFUXAEFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-10-9(12)13-8-5-7-3-2-4-11(7)6-8/h7-8H,2-6H2,1H3,(H,10,12).
What are the key properties of 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate?
2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate has a molecular weight of 184.24 g/mol, XLogP of 0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl N-methylcarbamate is sourced from PubChem (CID 176568416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).