About cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine
cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine (PubChem CID 176568430) has the molecular formula C12H25CdNO2
and a molecular weight of 327.75 g/mol. Its IUPAC name is cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine.
Molecular Properties
| Compound Name | cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine |
| PubChem CID | 176568430 |
| Molecular Formula | C12H25CdNO2 |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine |
| SMILES | C=C1CCC(COC(C)C)N(C)C1.CO.[Cd] |
| InChI | InChI=1S/C11H21NO.CH4O.Cd/c1-9(2)13-8-11-6-5-10(3)7-12(11)4;1-2;/h9,11H,3,5-8H2,1-2,4H3;2H,1H3; |
| InChIKey | WJRXGNUGBXLJSD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine?
The IUPAC name of cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine (CID 176568430) is cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine.
What is the SMILES notation for cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine?
The canonical SMILES for cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine is C=C1CCC(COC(C)C)N(C)C1.CO.[Cd].
What is the InChIKey of cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine?
The InChIKey is WJRXGNUGBXLJSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO.CH4O.Cd/c1-9(2)13-8-11-6-5-10(3)7-12(11)4;1-2;/h9,11H,3,5-8H2,1-2,4H3;2H,1H3;.
What are the key properties of cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine?
cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine has a molecular weight of 327.75 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;methanol;1-methyl-5-methylidene-2-(propan-2-yloxymethyl)piperidine is sourced from PubChem (CID 176568430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).