C13H25N3O — CID 176569123
[(3R)-3-piperidin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-6-yl]methanol (PubChem CID 176569123) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is [(3R)-3-piperidin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-6-yl]methanol.
| Compound Name | [(3R)-3-piperidin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 176569123 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | [(3R)-3-piperidin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-6-yl]methanol |
| SMILES | OCC1CCC2C(NC[C@@H]2C2CCCNC2)N1 |
| InChI | InChI=1S/C13H25N3O/c17-8-10-3-4-11-12(7-15-13(11)16-10)9-2-1-5-14-6-9/h9-17H,1-8H2/t9?,10?,11?,12-,13?/m1/s1 |
| InChIKey | AUUDIHLBGQTXNB-CRIDGIJHSA-N |
| XLogP | -0.11 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |