C18H29N3O — CID 176569271
2-[7-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-5-yl]-2,12-diazatricyclo[6.3.1.01,6]dodec-7-en-3-yl]ethanol (PubChem CID 176569271) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-[7-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-5-yl]-2,12-diazatricyclo[6.3.1.01,6]dodec-7-en-3-yl]ethanol.
| Compound Name | 2-[7-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-5-yl]-2,12-diazatricyclo[6.3.1.01,6]dodec-7-en-3-yl]ethanol |
|---|---|
| PubChem CID | 176569271 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 2-[7-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-5-yl]-2,12-diazatricyclo[6.3.1.01,6]dodec-7-en-3-yl]ethanol |
| SMILES | C[C@H]1NCCC=C1C1=C2CCCC3(N2)NC(CCO)CCC13 |
| InChI | InChI=1S/C18H29N3O/c1-12-14(4-3-10-19-12)17-15-7-6-13(8-11-22)20-18(15)9-2-5-16(17)21-18/h4,12-13,15,19-22H,2-3,5-11H2,1H3/t12-,13?,15?,18?/m1/s1 |
| InChIKey | VDBQWDAXTTZGIH-XWRJANFHSA-N |
| XLogP | 1.78 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |