About CID 176569404
CID 176569404 (PubChem CID 176569404) has the molecular formula C15H16FN2
and a molecular weight of 243.31 g/mol.
Molecular Properties
| Compound Name | CID 176569404 |
| PubChem CID | 176569404 |
| Molecular Formula | C15H16FN2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | — |
| SMILES | CC1C=C(C2=CN=C3[CH]C(F)=CC=C23)CN(C)C1 |
| InChI | InChI=1S/C15H16FN2/c1-10-5-11(9-18(2)8-10)14-7-17-15-6-12(16)3-4-13(14)15/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | GYIMMTGYYMREII-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 176569404 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176569404?
The IUPAC name of CID 176569404 (CID 176569404) is not available.
What is the SMILES notation for CID 176569404?
The canonical SMILES for CID 176569404 is CC1C=C(C2=CN=C3[CH]C(F)=CC=C23)CN(C)C1.
What is the InChIKey of CID 176569404?
The InChIKey is GYIMMTGYYMREII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN2/c1-10-5-11(9-18(2)8-10)14-7-17-15-6-12(16)3-4-13(14)15/h3-7,10H,8-9H2,1-2H3.
What are the key properties of CID 176569404?
CID 176569404 has a molecular weight of 243.31 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176569404 is sourced from PubChem (CID 176569404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).