C18H34N3+ — CID 176569506
4-hexyl-1-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridin-4-ium (PubChem CID 176569506) has the molecular formula C18H34N3+ and a molecular weight of 292.49 g/mol. Its IUPAC name is 4-hexyl-1-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridin-4-ium.
| Compound Name | 4-hexyl-1-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridin-4-ium |
|---|---|
| PubChem CID | 176569506 |
| Molecular Formula | C18H34N3+ |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.27 |
| IUPAC Name | 4-hexyl-1-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridin-4-ium |
| SMILES | CCCCCC[N+]12CCCCC1C(C1=CCCNC1)NC2 |
| InChI | InChI=1S/C18H34N3/c1-2-3-4-6-12-21-13-7-5-10-17(21)18(20-15-21)16-9-8-11-19-14-16/h9,17-20H,2-8,10-15H2,1H3/q+1 |
| InChIKey | IOCLQCRBJDSDJB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|