About 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen
6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen (PubChem CID 176569787) has the molecular formula C10H14F2N2
and a molecular weight of 200.23 g/mol. Its IUPAC name is 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen |
| PubChem CID | 176569787 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen |
| SMILES | CC.Cc1[nH]nc2c(F)c(F)ccc12.[H][H] |
| InChI | InChI=1S/C8H6F2N2.C2H6.H2/c1-4-5-2-3-6(9)7(10)8(5)12-11-4;1-2;/h2-3H,1H3,(H,11,12);1-2H3;1H |
| InChIKey | KXAPLPMXHAXEMO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen?
The IUPAC name of 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen (CID 176569787) is 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen.
What is the SMILES notation for 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen?
The canonical SMILES for 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen is CC.Cc1[nH]nc2c(F)c(F)ccc12.[H][H].
What is the InChIKey of 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen?
The InChIKey is KXAPLPMXHAXEMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2N2.C2H6.H2/c1-4-5-2-3-6(9)7(10)8(5)12-11-4;1-2;/h2-3H,1H3,(H,11,12);1-2H3;1H.
What are the key properties of 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen?
6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen has a molecular weight of 200.23 g/mol, XLogP of 3.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen is sourced from PubChem (CID 176569787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).