C10H14F2N2 — CID 176569787
6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen (PubChem CID 176569787) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen.
| Compound Name | 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 176569787 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6,7-difluoro-3-methyl-2H-indazole;ethane;molecular hydrogen |
| SMILES | CC.Cc1[nH]nc2c(F)c(F)ccc12.[H][H] |
| InChI | InChI=1S/C8H6F2N2.C2H6.H2/c1-4-5-2-3-6(9)7(10)8(5)12-11-4;1-2;/h2-3H,1H3,(H,11,12);1-2H3;1H |
| InChIKey | KXAPLPMXHAXEMO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |