C13H21N3 — CID 176569883
3-[(6S)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]-3,3a,4,5,6,7-hexahydro-2H-pyrrolo[2,3-b]pyridine (PubChem CID 176569883) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-[(6S)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]-3,3a,4,5,6,7-hexahydro-2H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[(6S)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]-3,3a,4,5,6,7-hexahydro-2H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 176569883 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3-[(6S)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]-3,3a,4,5,6,7-hexahydro-2H-pyrrolo[2,3-b]pyridine |
| SMILES | C[C@H]1C=C(C2CN=C3NCCCC32)CCN1 |
| InChI | InChI=1S/C13H21N3/c1-9-7-10(4-6-14-9)12-8-16-13-11(12)3-2-5-15-13/h7,9,11-12,14H,2-6,8H2,1H3,(H,15,16)/t9-,11?,12?/m0/s1 |
| InChIKey | YTVYZSWIFYZEMT-GCVQQVDUSA-N |
| XLogP | 1.32 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|