C14H25BrN2 — CID 176569917
2-bromo-3-[[(3R)-piperidin-3-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 176569917) has the molecular formula C14H25BrN2 and a molecular weight of 301.27 g/mol. Its IUPAC name is 2-bromo-3-[[(3R)-piperidin-3-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | 2-bromo-3-[[(3R)-piperidin-3-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 176569917 |
| Molecular Formula | C14H25BrN2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-bromo-3-[[(3R)-piperidin-3-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | BrC1NC2CCCCC2C1C[C@H]1CCCNC1 |
| InChI | InChI=1S/C14H25BrN2/c15-14-12(8-10-4-3-7-16-9-10)11-5-1-2-6-13(11)17-14/h10-14,16-17H,1-9H2/t10-,11?,12?,13?,14?/m1/s1 |
| InChIKey | BAVKQDJCMZWJJP-ZGCIAEMCSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|