About CID 176570022
CID 176570022 (PubChem CID 176570022) has the molecular formula C15H24NO2
and a molecular weight of 250.36 g/mol.
Molecular Properties
| Compound Name | CID 176570022 |
| PubChem CID | 176570022 |
| Molecular Formula | C15H24NO2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | — |
| SMILES | COC1=CC(C[C@H]2CCCNC2)=C(OC)[CH]C1C |
| InChI | InChI=1S/C15H24NO2/c1-11-7-15(18-3)13(9-14(11)17-2)8-12-5-4-6-16-10-12/h7,9,11-12,16H,4-6,8,10H2,1-3H3/t11?,12-/m1/s1 |
| InChIKey | AHODLRCMZOBYBT-PIJUOVFKSA-N |
| XLogP | 2.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 176570022 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176570022?
The IUPAC name of CID 176570022 (CID 176570022) is not available.
What is the SMILES notation for CID 176570022?
The canonical SMILES for CID 176570022 is COC1=CC(C[C@H]2CCCNC2)=C(OC)[CH]C1C.
What is the InChIKey of CID 176570022?
The InChIKey is AHODLRCMZOBYBT-PIJUOVFKSA-N. The full InChI is InChI=1S/C15H24NO2/c1-11-7-15(18-3)13(9-14(11)17-2)8-12-5-4-6-16-10-12/h7,9,11-12,16H,4-6,8,10H2,1-3H3/t11?,12-/m1/s1.
What are the key properties of CID 176570022?
CID 176570022 has a molecular weight of 250.36 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176570022 is sourced from PubChem (CID 176570022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).