About (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane
(3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane (PubChem CID 176570092) has the molecular formula C17H37NO
and a molecular weight of 271.49 g/mol. Its IUPAC name is (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane.
Molecular Properties
| Compound Name | (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane |
| PubChem CID | 176570092 |
| Molecular Formula | C17H37NO |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.29 |
| IUPAC Name | (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane |
| SMILES | C=C(OC)/C(=C\C)C(C)CC.CCC.CCCNC |
| InChI | InChI=1S/C10H18O.C4H11N.C3H8/c1-6-8(3)10(7-2)9(4)11-5;1-3-4-5-2;1-3-2/h7-8H,4,6H2,1-3,5H3;5H,3-4H2,1-2H3;3H2,1-2H3/b10-7-;; |
| InChIKey | UKRXVIAZGVWASN-QISVCDMNSA-N |
| XLogP | 5.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane?
The IUPAC name of (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane (CID 176570092) is (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane.
What is the SMILES notation for (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane?
The canonical SMILES for (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane is C=C(OC)/C(=C\C)C(C)CC.CCC.CCCNC.
What is the InChIKey of (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane?
The InChIKey is UKRXVIAZGVWASN-QISVCDMNSA-N. The full InChI is InChI=1S/C10H18O.C4H11N.C3H8/c1-6-8(3)10(7-2)9(4)11-5;1-3-4-5-2;1-3-2/h7-8H,4,6H2,1-3,5H3;5H,3-4H2,1-2H3;3H2,1-2H3/b10-7-;;.
What are the key properties of (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane?
(3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane has a molecular weight of 271.49 g/mol, XLogP of 5.17, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethylidene-2-methoxy-4-methylhex-1-ene;N-methylpropan-1-amine;propane is sourced from PubChem (CID 176570092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).