About (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane
(E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane (PubChem CID 176571014) has the molecular formula C16H31NS
and a molecular weight of 269.50 g/mol. Its IUPAC name is (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane.
Molecular Properties
| Compound Name | (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane |
| PubChem CID | 176571014 |
| Molecular Formula | C16H31NS |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane |
| SMILES | C/C=C(\CCCC#N)SCC.CC(C)C(C)(C)C |
| InChI | InChI=1S/C9H15NS.C7H16/c1-3-9(11-4-2)7-5-6-8-10;1-6(2)7(3,4)5/h3H,4-7H2,1-2H3;6H,1-5H3/b9-3+; |
| InChIKey | FQZMKAGONABULH-JSGFVSQVSA-N |
| XLogP | 6.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane?
The IUPAC name of (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane (CID 176571014) is (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane.
What is the SMILES notation for (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane?
The canonical SMILES for (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane is C/C=C(\CCCC#N)SCC.CC(C)C(C)(C)C.
What is the InChIKey of (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane?
The InChIKey is FQZMKAGONABULH-JSGFVSQVSA-N. The full InChI is InChI=1S/C9H15NS.C7H16/c1-3-9(11-4-2)7-5-6-8-10;1-6(2)7(3,4)5/h3H,4-7H2,1-2H3;6H,1-5H3/b9-3+;.
What are the key properties of (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane?
(E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane has a molecular weight of 269.50 g/mol, XLogP of 6.03, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-ethylsulfanylhept-5-enenitrile;2,2,3-trimethylbutane is sourced from PubChem (CID 176571014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).