C26H48 — CID 176571434
4-(2,3-dimethylbutan-2-yl)-1-methylcyclohexene;4-methyl-1,3-di(propan-2-yl)cyclohexene (PubChem CID 176571434) has the molecular formula C26H48 and a molecular weight of 360.67 g/mol. Its IUPAC name is 4-(2,3-dimethylbutan-2-yl)-1-methylcyclohexene;4-methyl-1,3-di(propan-2-yl)cyclohexene.
| Compound Name | 4-(2,3-dimethylbutan-2-yl)-1-methylcyclohexene;4-methyl-1,3-di(propan-2-yl)cyclohexene |
|---|---|
| PubChem CID | 176571434 |
| Molecular Formula | C26H48 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 360.38 |
| IUPAC Name | 4-(2,3-dimethylbutan-2-yl)-1-methylcyclohexene;4-methyl-1,3-di(propan-2-yl)cyclohexene |
| SMILES | CC(C)C1=CC(C(C)C)C(C)CC1.CC1=CCC(C(C)(C)C(C)C)CC1 |
| InChI | InChI=1S/2C13H24/c1-10(2)13(4,5)12-8-6-11(3)7-9-12;1-9(2)12-7-6-11(5)13(8-12)10(3)4/h6,10,12H,7-9H2,1-5H3;8-11,13H,6-7H2,1-5H3 |
| InChIKey | JVPDINZLEPNKBK-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|