C14H14F2N4O2S2 — CID 176571663
(Z)-1-[2-(difluoromethyl)-6-methoxypyrido[2,3-d]pyrimidin-4-yl]sulfanyl-4-(methylamino)-3-sulfanylbut-3-en-2-one (PubChem CID 176571663) has the molecular formula C14H14F2N4O2S2 and a molecular weight of 372.42 g/mol. Its IUPAC name is (Z)-1-[2-(difluoromethyl)-6-methoxypyrido[2,3-d]pyrimidin-4-yl]sulfanyl-4-(methylamino)-3-sulfanylbut-3-en-2-one.
| Compound Name | (Z)-1-[2-(difluoromethyl)-6-methoxypyrido[2,3-d]pyrimidin-4-yl]sulfanyl-4-(methylamino)-3-sulfanylbut-3-en-2-one |
|---|---|
| PubChem CID | 176571663 |
| Molecular Formula | C14H14F2N4O2S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | (Z)-1-[2-(difluoromethyl)-6-methoxypyrido[2,3-d]pyrimidin-4-yl]sulfanyl-4-(methylamino)-3-sulfanylbut-3-en-2-one |
| SMILES | CN/C=C(\S)C(=O)CSc1nc(C(F)F)nc2ncc(OC)cc12 |
| InChI | InChI=1S/C14H14F2N4O2S2/c1-17-5-10(23)9(21)6-24-14-8-3-7(22-2)4-18-12(8)19-13(20-14)11(15)16/h3-5,11,17,23H,6H2,1-2H3/b10-5- |
| InChIKey | VBVWRNIZIYFNPL-YHYXMXQVSA-N |
| XLogP | 2.62 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|