C19H32ClFN6O — CID 176572202
2-[4-(5-chloropiperidin-2-yl)piperazin-1-yl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]tridecan-9-one (PubChem CID 176572202) has the molecular formula C19H32ClFN6O and a molecular weight of 414.96 g/mol. Its IUPAC name is 2-[4-(5-chloropiperidin-2-yl)piperazin-1-yl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]tridecan-9-one.
| Compound Name | 2-[4-(5-chloropiperidin-2-yl)piperazin-1-yl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]tridecan-9-one |
|---|---|
| PubChem CID | 176572202 |
| Molecular Formula | C19H32ClFN6O |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-[4-(5-chloropiperidin-2-yl)piperazin-1-yl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]tridecan-9-one |
| SMILES | O=C1NCCN2C3C(CC(F)CC13)NC2N1CCN(C2CCC(Cl)CN2)CC1 |
| InChI | InChI=1S/C19H32ClFN6O/c20-12-1-2-16(23-11-12)25-5-7-26(8-6-25)19-24-15-10-13(21)9-14-17(15)27(19)4-3-22-18(14)28/h12-17,19,23-24H,1-11H2,(H,22,28) |
| InChIKey | MXECVLLHAWPEDR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|