C16H11FN4O2 — CID 176572203
6-fluoro-2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ylamino)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 176572203) has the molecular formula C16H11FN4O2 and a molecular weight of 310.29 g/mol. Its IUPAC name is 6-fluoro-2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ylamino)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 6-fluoro-2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ylamino)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 176572203 |
| Molecular Formula | C16H11FN4O2 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 6-fluoro-2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ylamino)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCn2c(Nc3cc4ccc3o4)nc3cc(F)cc1c32 |
| InChI | InChI=1S/C16H11FN4O2/c17-8-5-10-14-12(6-8)20-16(21(14)4-3-18-15(10)22)19-11-7-9-1-2-13(11)23-9/h1-2,5-7H,3-4H2,(H,18,22)(H,19,20) |
| InChIKey | YWUVTLUIYPXUAA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |