About CID 176572560
CID 176572560 (PubChem CID 176572560) has the molecular formula C7H9BN2O
and a molecular weight of 147.97 g/mol.
Molecular Properties
| Compound Name | CID 176572560 |
| PubChem CID | 176572560 |
| Molecular Formula | C7H9BN2O |
| Molecular Weight | 147.97 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | — |
| SMILES | [B]COc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C7H9BN2O/c1-5-3-6(2)10-7(9-5)11-4-8/h3H,4H2,1-2H3 |
| InChIKey | FARQFORXGULXTA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.97 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176572560 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176572560?
The IUPAC name of CID 176572560 (CID 176572560) is not available.
What is the SMILES notation for CID 176572560?
The canonical SMILES for CID 176572560 is [B]COc1nc(C)cc(C)n1.
What is the InChIKey of CID 176572560?
The InChIKey is FARQFORXGULXTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BN2O/c1-5-3-6(2)10-7(9-5)11-4-8/h3H,4H2,1-2H3.
What are the key properties of CID 176572560?
CID 176572560 has a molecular weight of 147.97 g/mol, XLogP of 0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176572560 is sourced from PubChem (CID 176572560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).