About 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene
2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene (PubChem CID 176572716) has the molecular formula C24H29FIN
and a molecular weight of 477.41 g/mol. Its IUPAC name is 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene.
Molecular Properties
| Compound Name | 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene |
| PubChem CID | 176572716 |
| Molecular Formula | C24H29FIN |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene |
| SMILES | CC.CCC#Cc1cc2cc(CI)ccc2n1CC.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H16IN.C7H7F.C2H6/c1-3-5-6-14-10-13-9-12(11-16)7-8-15(13)17(14)4-2;1-6-2-4-7(8)5-3-6;1-2/h7-10H,3-4,11H2,1-2H3;2-5H,1H3;1-2H3 |
| InChIKey | ZTNUZFASRSFGOM-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene?
The IUPAC name of 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene (CID 176572716) is 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene.
What is the SMILES notation for 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene?
The canonical SMILES for 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene is CC.CCC#Cc1cc2cc(CI)ccc2n1CC.Cc1ccc(F)cc1.
What is the InChIKey of 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene?
The InChIKey is ZTNUZFASRSFGOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16IN.C7H7F.C2H6/c1-3-5-6-14-10-13-9-12(11-16)7-8-15(13)17(14)4-2;1-6-2-4-7(8)5-3-6;1-2/h7-10H,3-4,11H2,1-2H3;2-5H,1H3;1-2H3.
What are the key properties of 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene?
2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene has a molecular weight of 477.41 g/mol, XLogP of 7.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-ynyl-1-ethyl-5-(iodomethyl)indole;ethane;1-fluoro-4-methylbenzene is sourced from PubChem (CID 176572716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).