About N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine
N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine (PubChem CID 176572735) has the molecular formula C24H31N3
and a molecular weight of 361.53 g/mol. Its IUPAC name is N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine |
| PubChem CID | 176572735 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine |
| SMILES | CCN(CC)Cc1ccc2c(c1)cc(C#CCNC1=CC=CCC1)n2CC |
| InChI | InChI=1S/C24H31N3/c1-4-26(5-2)19-20-14-15-24-21(17-20)18-23(27(24)6-3)13-10-16-25-22-11-8-7-9-12-22/h7-8,11,14-15,17-18,25H,4-6,9,12,16,19H2,1-3H3 |
| InChIKey | MIWOQCMLLKGFIU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine?
The IUPAC name of N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine (CID 176572735) is N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine?
The canonical SMILES for N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine is CCN(CC)Cc1ccc2c(c1)cc(C#CCNC1=CC=CCC1)n2CC.
What is the InChIKey of N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine?
The InChIKey is MIWOQCMLLKGFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3/c1-4-26(5-2)19-20-14-15-24-21(17-20)18-23(27(24)6-3)13-10-16-25-22-11-8-7-9-12-22/h7-8,11,14-15,17-18,25H,4-6,9,12,16,19H2,1-3H3.
What are the key properties of N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine?
N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine has a molecular weight of 361.53 g/mol, XLogP of 4.68, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[5-(diethylaminomethyl)-1-ethylindol-2-yl]prop-2-ynyl]cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 176572735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).