C14H9F3N4O3S — CID 176572832
4-[[5-(2,4-difluoro-3-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methyl]-6-fluoro-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 176572832) has the molecular formula C14H9F3N4O3S and a molecular weight of 370.31 g/mol. Its IUPAC name is 4-[[5-(2,4-difluoro-3-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methyl]-6-fluoro-4,6-diazaspiro[2.4]heptane-5,7-dione.
| Compound Name | 4-[[5-(2,4-difluoro-3-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methyl]-6-fluoro-4,6-diazaspiro[2.4]heptane-5,7-dione |
|---|---|
| PubChem CID | 176572832 |
| Molecular Formula | C14H9F3N4O3S |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 4-[[5-(2,4-difluoro-3-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methyl]-6-fluoro-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | O=C1N(F)C(=O)C2(CC2)N1Cc1nnc(-c2ccc(F)c(O)c2F)s1 |
| InChI | InChI=1S/C14H9F3N4O3S/c15-7-2-1-6(9(16)10(7)22)11-19-18-8(25-11)5-20-13(24)21(17)12(23)14(20)3-4-14/h1-2,22H,3-5H2 |
| InChIKey | KLBZWILDBXYDHM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|