C24H20BrF5N4O2S2 — CID 176572882
4-[(5-bromo-1,3,4-thiadiazol-2-yl)methyl]-6-[2,2,2-trifluoro-1-[2-fluoro-4-(4-fluorophenyl)phenyl]ethyl]-4,6-diazaspiro[2.4]heptane-5,7-dione;methylsulfanylmethane (PubChem CID 176572882) has the molecular formula C24H20BrF5N4O2S2 and a molecular weight of 635.48 g/mol. Its IUPAC name is 4-[(5-bromo-1,3,4-thiadiazol-2-yl)methyl]-6-[2,2,2-trifluoro-1-[2-fluoro-4-(4-fluorophenyl)phenyl]ethyl]-4,6-diazaspiro[2.4]heptane-5,7-dione;methylsulfanylmethane.
| Compound Name | 4-[(5-bromo-1,3,4-thiadiazol-2-yl)methyl]-6-[2,2,2-trifluoro-1-[2-fluoro-4-(4-fluorophenyl)phenyl]ethyl]-4,6-diazaspiro[2.4]heptane-5,7-dione;methylsulfanylmethane |
|---|---|
| PubChem CID | 176572882 |
| Molecular Formula | C24H20BrF5N4O2S2 |
| Molecular Weight | 635.48 g/mol |
| Exact Mass | 634.01 |
| IUPAC Name | 4-[(5-bromo-1,3,4-thiadiazol-2-yl)methyl]-6-[2,2,2-trifluoro-1-[2-fluoro-4-(4-fluorophenyl)phenyl]ethyl]-4,6-diazaspiro[2.4]heptane-5,7-dione;methylsulfanylmethane |
| SMILES | CSC.O=C1N(C(c2ccc(-c3ccc(F)cc3)cc2F)C(F)(F)F)C(=O)C2(CC2)N1Cc1nnc(Br)s1 |
| InChI | InChI=1S/C22H14BrF5N4O2S.C2H6S/c23-19-30-29-16(35-19)10-31-20(34)32(18(33)21(31)7-8-21)17(22(26,27)28)14-6-3-12(9-15(14)25)11-1-4-13(24)5-2-11;1-3-2/h1-6,9,17H,7-8,10H2;1-2H3 |
| InChIKey | ZWJATHIQIKCKRY-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|