C21H29N3O4 — CID 176573046
methyl 3-[4-(2,5-dimethyl-3H-pyrrol-4-yl)phenyl]-3-formamidopropanoate;pyrrolidin-3-ol (PubChem CID 176573046) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 3-[4-(2,5-dimethyl-3H-pyrrol-4-yl)phenyl]-3-formamidopropanoate;pyrrolidin-3-ol.
| Compound Name | methyl 3-[4-(2,5-dimethyl-3H-pyrrol-4-yl)phenyl]-3-formamidopropanoate;pyrrolidin-3-ol |
|---|---|
| PubChem CID | 176573046 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | methyl 3-[4-(2,5-dimethyl-3H-pyrrol-4-yl)phenyl]-3-formamidopropanoate;pyrrolidin-3-ol |
| SMILES | COC(=O)CC(NC=O)c1ccc(C2=C(C)N=C(C)C2)cc1.OC1CCNC1 |
| InChI | InChI=1S/C17H20N2O3.C4H9NO/c1-11-8-15(12(2)19-11)13-4-6-14(7-5-13)16(18-10-20)9-17(21)22-3;6-4-1-2-5-3-4/h4-7,10,16H,8-9H2,1-3H3,(H,18,20);4-6H,1-3H2 |
| InChIKey | WPBRQTLYDWVLHU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|