C20H22F2N3OS- — CID 176573487
CID 176573487 (PubChem CID 176573487) has the molecular formula C20H22F2N3OS- and a molecular weight of 390.48 g/mol.
| Compound Name | CID 176573487 |
|---|---|
| PubChem CID | 176573487 |
| Molecular Formula | C20H22F2N3OS- |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | — |
| SMILES | Fc1c(-c2ccccc2N2CCC(F)C2)[nH]c2ccccc12.[H]N=[S-](=O)CC |
| InChI | InChI=1S/C18H16F2N2.C2H6NOS/c19-12-9-10-22(11-12)16-8-4-2-6-14(16)18-17(20)13-5-1-3-7-15(13)21-18;1-2-5(3)4/h1-8,12,21H,9-11H2;3H,2H2,1H3/q;-1 |
| InChIKey | KERBRZIOCBHAQE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|