C29H25F2N5O4S2 — CID 176575385
N-[4-(3,4-difluorophenyl)-5-(pyridin-2-ylmethyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methylpyridine-2-sulfonamide (PubChem CID 176575385) has the molecular formula C29H25F2N5O4S2 and a molecular weight of 609.68 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-5-(pyridin-2-ylmethyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methylpyridine-2-sulfonamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-5-(pyridin-2-ylmethyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 176575385 |
| Molecular Formula | C29H25F2N5O4S2 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-5-(pyridin-2-ylmethyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methylpyridine-2-sulfonamide |
| SMILES | COc1cccc(CNc2cnc(S(=O)(=O)Nc3nc(-c4ccc(F)c(F)c4)c(Cc4ccccn4)s3)c(C)c2)c1O |
| InChI | InChI=1S/C29H25F2N5O4S2/c1-17-12-21(33-15-19-6-5-8-24(40-2)27(19)37)16-34-28(17)42(38,39)36-29-35-26(18-9-10-22(30)23(31)13-18)25(41-29)14-20-7-3-4-11-32-20/h3-13,16,33,37H,14-15H2,1-2H3,(H,35,36) |
| InChIKey | FHWJGIHFHYDPND-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|