C26H25ClFN4O4S2- — CID 176575431
4-(3-chloro-4-fluorophenyl)-5-cyclopropyl-1,3-thiazol-2-amine;5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methylpyridine-2-sulfinate (PubChem CID 176575431) has the molecular formula C26H25ClFN4O4S2- and a molecular weight of 576.10 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-5-cyclopropyl-1,3-thiazol-2-amine;5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methylpyridine-2-sulfinate.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-5-cyclopropyl-1,3-thiazol-2-amine;5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methylpyridine-2-sulfinate |
|---|---|
| PubChem CID | 176575431 |
| Molecular Formula | C26H25ClFN4O4S2- |
| Molecular Weight | 576.10 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-5-cyclopropyl-1,3-thiazol-2-amine;5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methylpyridine-2-sulfinate |
| SMILES | COc1cccc(CNc2cnc(S(=O)[O-])c(C)c2)c1O.Nc1nc(-c2ccc(F)c(Cl)c2)c(C2CC2)s1 |
| InChI | InChI=1S/C14H16N2O4S.C12H10ClFN2S/c1-9-6-11(8-16-14(9)21(18)19)15-7-10-4-3-5-12(20-2)13(10)17;13-8-5-7(3-4-9(8)14)10-11(6-1-2-6)17-12(15)16-10/h3-6,8,15,17H,7H2,1-2H3,(H,18,19);3-6H,1-2H2,(H2,15,16)/p-1 |
| InChIKey | DOKPBYPQDOFMEX-UHFFFAOYSA-M |
| XLogP | 6.02 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.10 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|