About ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate
ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate (PubChem CID 176575986) has the molecular formula C17H34N2O4
and a molecular weight of 330.47 g/mol. Its IUPAC name is ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate.
Molecular Properties
| Compound Name | ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate |
| PubChem CID | 176575986 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate |
| SMILES | CCC1CCCCC1.CCOC(=O)CNCCOCCNC=O |
| InChI | InChI=1S/C9H18N2O4.C8H16/c1-2-15-9(13)7-10-3-5-14-6-4-11-8-12;1-2-8-6-4-3-5-7-8/h8,10H,2-7H2,1H3,(H,11,12);8H,2-7H2,1H3 |
| InChIKey | VCUGRCCTDITBBV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate?
The IUPAC name of ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate (CID 176575986) is ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate.
What is the SMILES notation for ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate?
The canonical SMILES for ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate is CCC1CCCCC1.CCOC(=O)CNCCOCCNC=O.
What is the InChIKey of ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate?
The InChIKey is VCUGRCCTDITBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O4.C8H16/c1-2-15-9(13)7-10-3-5-14-6-4-11-8-12;1-2-8-6-4-3-5-7-8/h8,10H,2-7H2,1H3,(H,11,12);8H,2-7H2,1H3.
What are the key properties of ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate?
ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate has a molecular weight of 330.47 g/mol, XLogP of 1.88, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethylcyclohexane;ethyl 2-[2-(2-formamidoethoxy)ethylamino]acetate is sourced from PubChem (CID 176575986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).