C32H49ClN8O3S2 — CID 176576236
CID 176576236 (PubChem CID 176576236) has the molecular formula C32H49ClN8O3S2 and a molecular weight of 693.38 g/mol.
| Compound Name | CID 176576236 |
|---|---|
| PubChem CID | 176576236 |
| Molecular Formula | C32H49ClN8O3S2 |
| Molecular Weight | 693.38 g/mol |
| Exact Mass | 692.31 |
| IUPAC Name | — |
| SMILES | CC.CC(C)(C)OC(=O)NC1(C(=O)NC(CCN2CCNCC2)c2ccc(Cl)cc2)CCN(c2ncnc3[nH]ccc23)CC1.SS |
| InChI | InChI=1S/C30H41ClN8O3.C2H6.H2S2/c1-29(2,3)42-28(41)37-30(10-16-39(17-11-30)26-23-8-12-33-25(23)34-20-35-26)27(40)36-24(21-4-6-22(31)7-5-21)9-15-38-18-13-32-14-19-38;2*1-2/h4-8,12,20,24,32H,9-11,13-19H2,1-3H3,(H,36,40)(H,37,41)(H,33,34,35);1-2H3;1-2H |
| InChIKey | GZRMUJKJKRFGQW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|