C25H35FN2O3 — CID 176576364
3-(1-acetylpiperidin-3-yl)-N-[(1R)-1-cyclohexyl-3-methyl-2-oxobutyl]-2-fluorobenzamide (PubChem CID 176576364) has the molecular formula C25H35FN2O3 and a molecular weight of 430.56 g/mol. Its IUPAC name is 3-(1-acetylpiperidin-3-yl)-N-[(1R)-1-cyclohexyl-3-methyl-2-oxobutyl]-2-fluorobenzamide.
| Compound Name | 3-(1-acetylpiperidin-3-yl)-N-[(1R)-1-cyclohexyl-3-methyl-2-oxobutyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 176576364 |
| Molecular Formula | C25H35FN2O3 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 3-(1-acetylpiperidin-3-yl)-N-[(1R)-1-cyclohexyl-3-methyl-2-oxobutyl]-2-fluorobenzamide |
| SMILES | CC(=O)N1CCCC(c2cccc(C(=O)N[C@@H](C(=O)C(C)C)C3CCCCC3)c2F)C1 |
| InChI | InChI=1S/C25H35FN2O3/c1-16(2)24(30)23(18-9-5-4-6-10-18)27-25(31)21-13-7-12-20(22(21)26)19-11-8-14-28(15-19)17(3)29/h7,12-13,16,18-19,23H,4-6,8-11,14-15H2,1-3H3,(H,27,31)/t19?,23-/m1/s1 |
| InChIKey | NAISDUWHEDMADB-LEQGEALCSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |