C20H40N4O — CID 176576642
1-[4-[[1-[3-(ethylamino)propyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-methylbutan-2-one (PubChem CID 176576642) has the molecular formula C20H40N4O and a molecular weight of 352.57 g/mol. Its IUPAC name is 1-[4-[[1-[3-(ethylamino)propyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-methylbutan-2-one.
| Compound Name | 1-[4-[[1-[3-(ethylamino)propyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 176576642 |
| Molecular Formula | C20H40N4O |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | 1-[4-[[1-[3-(ethylamino)propyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-methylbutan-2-one |
| SMILES | CCNCCCN1CCC(CN2CCN(CC(=O)C(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H40N4O/c1-4-21-8-5-9-22-10-6-19(7-11-22)16-23-12-14-24(15-13-23)17-20(25)18(2)3/h18-19,21H,4-17H2,1-3H3 |
| InChIKey | KHCBMGBXNQCROQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|