About CID 176577846
CID 176577846 (PubChem CID 176577846) has the molecular formula C49H61ClN13O5S2Si
and a molecular weight of 1039.79 g/mol.
Molecular Properties
| Compound Name | CID 176577846 |
| PubChem CID | 176577846 |
| Molecular Formula | C49H61ClN13O5S2Si |
| Molecular Weight | 1039.79 g/mol |
| Exact Mass | 1038.38 |
| IUPAC Name | — |
| SMILES | Cc1cc(-n2ccnc2)ccc1CSc1nnc(C(=O)N(C)CCOCCOCCC(=O)N2CCN(CC[C@@H](c3ccc(Cl)cc3)C(C)N([Si])C(=O)C3(N)CCN(c4ncnc5[nH]ccc45)CC3)CC2)s1 |
| InChI | InChI=1S/C49H61ClN13O5S2Si/c1-34-30-39(62-20-16-52-33-62)9-6-37(34)31-69-48-57-56-45(70-48)46(65)58(3)25-27-68-29-28-67-26-12-42(64)60-23-21-59(22-24-60)17-11-40(36-4-7-38(50)8-5-36)35(2)63(71)47(66)49(51)13-18-61(19-14-49)44-41-10-15-53-43(41)54-32-55-44/h4-10,15-16,20,30,32-33,35,40H,11-14,17-19,21-29,31,51H2,1-3H3,(H,53,54,55)/t35?,40-/m1/s1 |
| InChIKey | TVQAYNZYUOGYLW-FQRIYGLTSA-N |
| XLogP | 5.36 |
| TPSA | 197.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1039.79 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176577846 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176577846?
The IUPAC name of CID 176577846 (CID 176577846) is not available.
What is the SMILES notation for CID 176577846?
The canonical SMILES for CID 176577846 is Cc1cc(-n2ccnc2)ccc1CSc1nnc(C(=O)N(C)CCOCCOCCC(=O)N2CCN(CC[C@@H](c3ccc(Cl)cc3)C(C)N([Si])C(=O)C3(N)CCN(c4ncnc5[nH]ccc45)CC3)CC2)s1.
What is the InChIKey of CID 176577846?
The InChIKey is TVQAYNZYUOGYLW-FQRIYGLTSA-N. The full InChI is InChI=1S/C49H61ClN13O5S2Si/c1-34-30-39(62-20-16-52-33-62)9-6-37(34)31-69-48-57-56-45(70-48)46(65)58(3)25-27-68-29-28-67-26-12-42(64)60-23-21-59(22-24-60)17-11-40(36-4-7-38(50)8-5-36)35(2)63(71)47(66)49(51)13-18-61(19-14-49)44-41-10-15-53-43(41)54-32-55-44/h4-10,15-16,20,30,32-33,35,40H,11-14,17-19,21-29,31,51H2,1-3H3,(H,53,54,55)/t35?,40-/m1/s1.
What are the key properties of CID 176577846?
CID 176577846 has a molecular weight of 1039.79 g/mol, XLogP of 5.36, 22 rotatable bonds, 2 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176577846 is sourced from PubChem (CID 176577846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).