About tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate
tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate (PubChem CID 176580666) has the molecular formula C20H27IN3O3+
and a molecular weight of 484.36 g/mol. Its IUPAC name is tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate |
| PubChem CID | 176580666 |
| Molecular Formula | C20H27IN3O3+ |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2cccc(OC3=C[NH2+]NC(I)=C3)c2)C1 |
| InChI | InChI=1S/C20H26IN3O3/c1-20(2,3)27-19(25)24-9-5-7-15(13-24)14-6-4-8-16(10-14)26-17-11-18(21)23-22-12-17/h4,6,8,10-12,15,22-23H,5,7,9,13H2,1-3H3/p+1 |
| InChIKey | YETBIPHFBPTOHN-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate (CID 176580666) is tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC(c2cccc(OC3=C[NH2+]NC(I)=C3)c2)C1.
What is the InChIKey of tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate?
The InChIKey is YETBIPHFBPTOHN-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H26IN3O3/c1-20(2,3)27-19(25)24-9-5-7-15(13-24)14-6-4-8-16(10-14)26-17-11-18(21)23-22-12-17/h4,6,8,10-12,15,22-23H,5,7,9,13H2,1-3H3/p+1.
What are the key properties of tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate?
tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate has a molecular weight of 484.36 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[3-[(6-iodo-1,2-dihydropyridazin-2-ium-4-yl)oxy]phenyl]piperidine-1-carboxylate is sourced from PubChem (CID 176580666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).