C18H29FN4O — CID 176581434
(3Z,4Z)-2-[4-(azetidin-3-ylmethyl)piperazin-1-yl]-3-(1-fluoroethylidene)-N-methylhepta-4,6-dienamide (PubChem CID 176581434) has the molecular formula C18H29FN4O and a molecular weight of 336.45 g/mol. Its IUPAC name is (3Z,4Z)-2-[4-(azetidin-3-ylmethyl)piperazin-1-yl]-3-(1-fluoroethylidene)-N-methylhepta-4,6-dienamide.
| Compound Name | (3Z,4Z)-2-[4-(azetidin-3-ylmethyl)piperazin-1-yl]-3-(1-fluoroethylidene)-N-methylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 176581434 |
| Molecular Formula | C18H29FN4O |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (3Z,4Z)-2-[4-(azetidin-3-ylmethyl)piperazin-1-yl]-3-(1-fluoroethylidene)-N-methylhepta-4,6-dienamide |
| SMILES | C=C/C=C\C(=C(/C)F)C(C(=O)NC)N1CCN(CC2CNC2)CC1 |
| InChI | InChI=1S/C18H29FN4O/c1-4-5-6-16(14(2)19)17(18(24)20-3)23-9-7-22(8-10-23)13-15-11-21-12-15/h4-6,15,17,21H,1,7-13H2,2-3H3,(H,20,24)/b6-5-,16-14- |
| InChIKey | LJDQBRSEQAILGP-KEHNZSNVSA-N |
| XLogP | 0.92 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|