C18H39N3O — CID 176581794
ethane;1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine (PubChem CID 176581794) has the molecular formula C18H39N3O and a molecular weight of 313.53 g/mol. Its IUPAC name is ethane;1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine.
| Compound Name | ethane;1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 176581794 |
| Molecular Formula | C18H39N3O |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.31 |
| IUPAC Name | ethane;1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine |
| SMILES | CC.COCCN1CCC(CN2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C16H33N3O.C2H6/c1-15(2)19-10-8-18(9-11-19)14-16-4-6-17(7-5-16)12-13-20-3;1-2/h15-16H,4-14H2,1-3H3;1-2H3 |
| InChIKey | UGBPMPXXGYLTNE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |