2,6-difluoro-4-pyridin-2-ylbenzoic acid

C12H7F2NO2 — CID 176582239

IUPAC2,6-difluoro-4-pyridin-2-ylbenzoic acid
SMILESO=C(O)c1c(F)cc(-c2ccccn2)cc1F
InChIInChI=1S/C12H7F2NO2/c13-8-5-7(10-3-1-2-4-15-10)6-9(14)11(8)12(16)17/h1-6H,(H,16,17)
InChIKeyKJCRTPPYOJKCSF-UHFFFAOYSA-N
MW235.19 g/mol
LogP2.72
Rot. Bonds2

About 2,6-difluoro-4-pyridin-2-ylbenzoic acid

2,6-difluoro-4-pyridin-2-ylbenzoic acid (PubChem CID 176582239) has the molecular formula C12H7F2NO2 and a molecular weight of 235.19 g/mol. Its IUPAC name is 2,6-difluoro-4-pyridin-2-ylbenzoic acid.

Molecular Properties

Compound Name2,6-difluoro-4-pyridin-2-ylbenzoic acid
PubChem CID176582239
Molecular FormulaC12H7F2NO2
Molecular Weight235.19 g/mol
Exact Mass235.04
IUPAC Name2,6-difluoro-4-pyridin-2-ylbenzoic acid
SMILESO=C(O)c1c(F)cc(-c2ccccn2)cc1F
InChIInChI=1S/C12H7F2NO2/c13-8-5-7(10-3-1-2-4-15-10)6-9(14)11(8)12(16)17/h1-6H,(H,16,17)
InChIKeyKJCRTPPYOJKCSF-UHFFFAOYSA-N
XLogP2.72
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.19
LogP ≤ 52.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,6-difluoro-4-pyridin-2-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-fluoro-5-pyridin-2-ylbenzoic acid
CID 63679251
2-(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;osmium;bis(2-pyridin-2-ylpyridine)
CID 162025014
4-fluoro-6-pyridin-2-yl-2,3-dihydro-1H-indene-2-carboxylic acid
CID 170593233
2,6-difluoro-4-(2-fluorophenyl)benzoic acid
CID 46312128
2-phenylpyridine;propan-2-one
CID 174845023
2-(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;bis(2-pyridin-2-ylpyridine);ruthenium
CID 14951635
2-pyridin-2-ylpyridine-4-carboxylic acid;dihydrochloride
CID 91928344
2-fluoro-4-(methylamino)-6-pyridin-2-ylpyrimidine-5-carboxylic acid
CID 67262007
2-amino-6-fluoro-4-pyrimidin-2-ylbenzoic acid
CID 165451224
4-methyl-6-pyridin-2-ylpyrimidine-5-carboxylic acid
CID 82471218
3-fluoro-2-methoxy-5-pyridin-2-ylpyridine
CID 175955577
iridium;pyridine-2-carboxylic acid;2-(3,4,5-trifluorobenzene-6-id-1-yl)pyridine
CID 170539912

Frequently Asked Questions

What is the IUPAC name of 2,6-difluoro-4-pyridin-2-ylbenzoic acid?
The IUPAC name of 2,6-difluoro-4-pyridin-2-ylbenzoic acid (CID 176582239) is 2,6-difluoro-4-pyridin-2-ylbenzoic acid.
What is the SMILES notation for 2,6-difluoro-4-pyridin-2-ylbenzoic acid?
The canonical SMILES for 2,6-difluoro-4-pyridin-2-ylbenzoic acid is O=C(O)c1c(F)cc(-c2ccccn2)cc1F.
What is the InChIKey of 2,6-difluoro-4-pyridin-2-ylbenzoic acid?
The InChIKey is KJCRTPPYOJKCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F2NO2/c13-8-5-7(10-3-1-2-4-15-10)6-9(14)11(8)12(16)17/h1-6H,(H,16,17).
What are the key properties of 2,6-difluoro-4-pyridin-2-ylbenzoic acid?
2,6-difluoro-4-pyridin-2-ylbenzoic acid has a molecular weight of 235.19 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-4-pyridin-2-ylbenzoic acid is sourced from PubChem (CID 176582239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).