C50H53N3O3S — CID 176584013
4-[4-[3-tert-butyl-5-[6-(2,2-dimethylpropyl)furo[3,2-d]pyrimidin-4-yl]phenyl]-7-[2,6-di(propan-2-yl)phenyl]-1,3-benzothiazol-2-yl]-2,3-dimethyl-1-benzofuran-5-ol (PubChem CID 176584013) has the molecular formula C50H53N3O3S and a molecular weight of 776.06 g/mol. Its IUPAC name is 4-[4-[3-tert-butyl-5-[6-(2,2-dimethylpropyl)furo[3,2-d]pyrimidin-4-yl]phenyl]-7-[2,6-di(propan-2-yl)phenyl]-1,3-benzothiazol-2-yl]-2,3-dimethyl-1-benzofuran-5-ol.
| Compound Name | 4-[4-[3-tert-butyl-5-[6-(2,2-dimethylpropyl)furo[3,2-d]pyrimidin-4-yl]phenyl]-7-[2,6-di(propan-2-yl)phenyl]-1,3-benzothiazol-2-yl]-2,3-dimethyl-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 176584013 |
| Molecular Formula | C50H53N3O3S |
| Molecular Weight | 776.06 g/mol |
| Exact Mass | 775.38 |
| IUPAC Name | 4-[4-[3-tert-butyl-5-[6-(2,2-dimethylpropyl)furo[3,2-d]pyrimidin-4-yl]phenyl]-7-[2,6-di(propan-2-yl)phenyl]-1,3-benzothiazol-2-yl]-2,3-dimethyl-1-benzofuran-5-ol |
| SMILES | Cc1oc2ccc(O)c(-c3nc4c(-c5cc(-c6ncnc7cc(CC(C)(C)C)oc67)cc(C(C)(C)C)c5)ccc(-c5c(C(C)C)cccc5C(C)C)c4s3)c2c1C |
| InChI | InChI=1S/C50H53N3O3S/c1-26(2)34-14-13-15-35(27(3)4)42(34)37-17-16-36(45-47(37)57-48(53-45)43-39(54)18-19-40-41(43)28(5)29(6)55-40)30-20-31(22-32(21-30)50(10,11)12)44-46-38(51-25-52-44)23-33(56-46)24-49(7,8)9/h13-23,25-27,54H,24H2,1-12H3 |
| InChIKey | ZHQORAAEYIQRMA-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.06 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |