C30H20Br4O2 — CID 176584593
2,6-dibromo-4-[1-(3,5-dibromo-4-hydroxyphenyl)-1-(4-naphthalen-1-ylphenyl)ethyl]phenol (PubChem CID 176584593) has the molecular formula C30H20Br4O2 and a molecular weight of 732.10 g/mol. Its IUPAC name is 2,6-dibromo-4-[1-(3,5-dibromo-4-hydroxyphenyl)-1-(4-naphthalen-1-ylphenyl)ethyl]phenol.
| Compound Name | 2,6-dibromo-4-[1-(3,5-dibromo-4-hydroxyphenyl)-1-(4-naphthalen-1-ylphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 176584593 |
| Molecular Formula | C30H20Br4O2 |
| Molecular Weight | 732.10 g/mol |
| Exact Mass | 727.82 |
| IUPAC Name | 2,6-dibromo-4-[1-(3,5-dibromo-4-hydroxyphenyl)-1-(4-naphthalen-1-ylphenyl)ethyl]phenol |
| SMILES | CC(c1ccc(-c2cccc3ccccc23)cc1)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C30H20Br4O2/c1-30(20-13-24(31)28(35)25(32)14-20,21-15-26(33)29(36)27(34)16-21)19-11-9-18(10-12-19)23-8-4-6-17-5-2-3-7-22(17)23/h2-16,35-36H,1H3 |
| InChIKey | XCZDXIMSUGTJGU-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.10 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|